C19H27NO — CID 70660881
4-[[(1R,5S)-3-bicyclo[3.2.1]octanyl]oxy]-1-phenylpiperidine (PubChem CID 70660881) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is 4-[[(1R,5S)-3-bicyclo[3.2.1]octanyl]oxy]-1-phenylpiperidine.
| Compound Name | 4-[[(1R,5S)-3-bicyclo[3.2.1]octanyl]oxy]-1-phenylpiperidine |
|---|---|
| PubChem CID | 70660881 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 4-[[(1R,5S)-3-bicyclo[3.2.1]octanyl]oxy]-1-phenylpiperidine |
| SMILES | c1ccc(N2CCC(OC3C[C@H]4CC[C@@H](C3)C4)CC2)cc1 |
| InChI | InChI=1S/C19H27NO/c1-2-4-17(5-3-1)20-10-8-18(9-11-20)21-19-13-15-6-7-16(12-15)14-19/h1-5,15-16,18-19H,6-14H2/t15-,16+,19? |
| InChIKey | HXFMSBCODFPJFP-MCPYQZEQSA-N |
| XLogP | 4.25 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |