C21H28F2S — CID 155032456
tert-butyl-(3,3-difluoropentyl)-diphenyl-λ4-sulfane (PubChem CID 155032456) has the molecular formula C21H28F2S and a molecular weight of 350.52 g/mol. Its IUPAC name is tert-butyl-(3,3-difluoropentyl)-diphenyl-λ4-sulfane.
| Compound Name | tert-butyl-(3,3-difluoropentyl)-diphenyl-λ4-sulfane |
|---|---|
| PubChem CID | 155032456 |
| Molecular Formula | C21H28F2S |
| Molecular Weight | 350.52 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | tert-butyl-(3,3-difluoropentyl)-diphenyl-λ4-sulfane |
| SMILES | CCC(F)(F)CCS(c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C21H28F2S/c1-5-21(22,23)16-17-24(20(2,3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15H,5,16-17H2,1-4H3 |
| InChIKey | YMQNDOPCQBXEPU-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.52 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |