C15H19N3O4 — CID 15503276
(2E)-2-(1-hydroxy-4,4,5,5-tetramethylimidazolidin-2-ylidene)-1-(4-nitrophenyl)ethanone (PubChem CID 15503276) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is (2E)-2-(1-hydroxy-4,4,5,5-tetramethylimidazolidin-2-ylidene)-1-(4-nitrophenyl)ethanone.
| Compound Name | (2E)-2-(1-hydroxy-4,4,5,5-tetramethylimidazolidin-2-ylidene)-1-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 15503276 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (2E)-2-(1-hydroxy-4,4,5,5-tetramethylimidazolidin-2-ylidene)-1-(4-nitrophenyl)ethanone |
| SMILES | CC1(C)N/C(=C\C(=O)c2ccc([N+](=O)[O-])cc2)N(O)C1(C)C |
| InChI | InChI=1S/C15H19N3O4/c1-14(2)15(3,4)17(20)13(16-14)9-12(19)10-5-7-11(8-6-10)18(21)22/h5-9,16,20H,1-4H3/b13-9+ |
| InChIKey | CMMYNFNNIJRDLL-UKTHLTGXSA-N |
| XLogP | 2.47 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|