C19H27FN2O3 — CID 155035952
(2S)-2-amino-2-cycloheptyl-N-[2-fluoro-4-[(2S,3R)-3-hydroxy-4-oxobutan-2-yl]phenyl]acetamide (PubChem CID 155035952) has the molecular formula C19H27FN2O3 and a molecular weight of 350.43 g/mol. Its IUPAC name is (2S)-2-amino-2-cycloheptyl-N-[2-fluoro-4-[(2S,3R)-3-hydroxy-4-oxobutan-2-yl]phenyl]acetamide.
| Compound Name | (2S)-2-amino-2-cycloheptyl-N-[2-fluoro-4-[(2S,3R)-3-hydroxy-4-oxobutan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 155035952 |
| Molecular Formula | C19H27FN2O3 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | (2S)-2-amino-2-cycloheptyl-N-[2-fluoro-4-[(2S,3R)-3-hydroxy-4-oxobutan-2-yl]phenyl]acetamide |
| SMILES | C[C@@H](c1ccc(NC(=O)[C@@H](N)C2CCCCCC2)c(F)c1)[C@@H](O)C=O |
| InChI | InChI=1S/C19H27FN2O3/c1-12(17(24)11-23)14-8-9-16(15(20)10-14)22-19(25)18(21)13-6-4-2-3-5-7-13/h8-13,17-18,24H,2-7,21H2,1H3,(H,22,25)/t12-,17-,18-/m0/s1 |
| InChIKey | JYEUKFDWYQPGEH-IGNZVWTISA-N |
| XLogP | 2.73 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|