C34H35N3O5S — CID 155036420
N-[2-[(19S)-19-ethyl-19-(methylsulfanylmethoxy)-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]ethyl]-N-propan-2-ylbenzamide (PubChem CID 155036420) has the molecular formula C34H35N3O5S and a molecular weight of 597.74 g/mol. Its IUPAC name is N-[2-[(19S)-19-ethyl-19-(methylsulfanylmethoxy)-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]ethyl]-N-propan-2-ylbenzamide.
| Compound Name | N-[2-[(19S)-19-ethyl-19-(methylsulfanylmethoxy)-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]ethyl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 155036420 |
| Molecular Formula | C34H35N3O5S |
| Molecular Weight | 597.74 g/mol |
| Exact Mass | 597.23 |
| IUPAC Name | N-[2-[(19S)-19-ethyl-19-(methylsulfanylmethoxy)-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]ethyl]-N-propan-2-ylbenzamide |
| SMILES | CC[C@@]1(OCSC)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccccc1c2CCN(C(=O)c1ccccc1)C(C)C |
| InChI | InChI=1S/C34H35N3O5S/c1-5-34(42-20-43-4)27-17-29-30-25(18-37(29)32(39)26(27)19-41-33(34)40)23(24-13-9-10-14-28(24)35-30)15-16-36(21(2)3)31(38)22-11-7-6-8-12-22/h6-14,17,21H,5,15-16,18-20H2,1-4H3/t34-/m0/s1 |
| InChIKey | BJVVEGDUMGIMFN-UMSFTDKQSA-N |
| XLogP | 5.52 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.74 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|