C27H30N2O5SSi — CID 25260612
S-[[2-[(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]ethyl-dimethylsilyl]methyl] ethanethioate (PubChem CID 25260612) has the molecular formula C27H30N2O5SSi and a molecular weight of 522.70 g/mol. Its IUPAC name is S-[[2-[(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]ethyl-dimethylsilyl]methyl] ethanethioate.
| Compound Name | S-[[2-[(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]ethyl-dimethylsilyl]methyl] ethanethioate |
|---|---|
| PubChem CID | 25260612 |
| Molecular Formula | C27H30N2O5SSi |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | S-[[2-[(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]ethyl-dimethylsilyl]methyl] ethanethioate |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccccc1c2CC[Si](C)(C)CSC(C)=O |
| InChI | InChI=1S/C27H30N2O5SSi/c1-5-27(33)21-12-23-24-19(13-29(23)25(31)20(21)14-34-26(27)32)17(18-8-6-7-9-22(18)28-24)10-11-36(3,4)15-35-16(2)30/h6-9,12,33H,5,10-11,13-15H2,1-4H3/t27-/m0/s1 |
| InChIKey | RJKGGIZEMCPCQS-MHZLTWQESA-N |
| XLogP | 4.15 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|