C32H35N3O5Si — CID 25260922
(19S)-10-[2-[dimethyl-[3-(2-oxo-1-pyridinyl)propyl]silyl]ethyl]-19-ethyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione (PubChem CID 25260922) has the molecular formula C32H35N3O5Si and a molecular weight of 569.73 g/mol. Its IUPAC name is (19S)-10-[2-[dimethyl-[3-(2-oxo-1-pyridinyl)propyl]silyl]ethyl]-19-ethyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione.
| Compound Name | (19S)-10-[2-[dimethyl-[3-(2-oxo-1-pyridinyl)propyl]silyl]ethyl]-19-ethyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 25260922 |
| Molecular Formula | C32H35N3O5Si |
| Molecular Weight | 569.73 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | (19S)-10-[2-[dimethyl-[3-(2-oxo-1-pyridinyl)propyl]silyl]ethyl]-19-ethyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccccc1c2CC[Si](C)(C)CCCn1ccccc1=O |
| InChI | InChI=1S/C32H35N3O5Si/c1-4-32(39)25-18-27-29-23(19-35(27)30(37)24(25)20-40-31(32)38)21(22-10-5-6-11-26(22)33-29)13-17-41(2,3)16-9-15-34-14-8-7-12-28(34)36/h5-8,10-12,14,18,39H,4,9,13,15-17,19-20H2,1-3H3/t32-/m0/s1 |
| InChIKey | ZRTAORNNDKDIOC-YTTGMZPUSA-N |
| XLogP | 4.58 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.73 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|