C14H16N2O2S — CID 155037577
4-[3-(oxolan-3-yloxymethyl)phenyl]-1,3-thiazol-2-amine (PubChem CID 155037577) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is 4-[3-(oxolan-3-yloxymethyl)phenyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[3-(oxolan-3-yloxymethyl)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 155037577 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 4-[3-(oxolan-3-yloxymethyl)phenyl]-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2cccc(COC3CCOC3)c2)cs1 |
| InChI | InChI=1S/C14H16N2O2S/c15-14-16-13(9-19-14)11-3-1-2-10(6-11)7-18-12-4-5-17-8-12/h1-3,6,9,12H,4-5,7-8H2,(H2,15,16) |
| InChIKey | YAXNJMSHNPQXFD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |