C17H18O5S — CID 138032297
4-methoxy-5-[3-(oxolan-3-yloxymethyl)phenyl]thiophene-2-carboxylic acid (PubChem CID 138032297) has the molecular formula C17H18O5S and a molecular weight of 334.39 g/mol. Its IUPAC name is 4-methoxy-5-[3-(oxolan-3-yloxymethyl)phenyl]thiophene-2-carboxylic acid.
| Compound Name | 4-methoxy-5-[3-(oxolan-3-yloxymethyl)phenyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 138032297 |
| Molecular Formula | C17H18O5S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 4-methoxy-5-[3-(oxolan-3-yloxymethyl)phenyl]thiophene-2-carboxylic acid |
| SMILES | COc1cc(C(=O)O)sc1-c1cccc(COC2CCOC2)c1 |
| InChI | InChI=1S/C17H18O5S/c1-20-14-8-15(17(18)19)23-16(14)12-4-2-3-11(7-12)9-22-13-5-6-21-10-13/h2-4,7-8,13H,5-6,9-10H2,1H3,(H,18,19) |
| InChIKey | YLZWFCMUGFDVFD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |