C10H12O4S — CID 63641042
3-(oxolan-3-yloxymethyl)thiophene-2-carboxylic acid (PubChem CID 63641042) has the molecular formula C10H12O4S and a molecular weight of 228.27 g/mol. Its IUPAC name is 3-(oxolan-3-yloxymethyl)thiophene-2-carboxylic acid.
| Compound Name | 3-(oxolan-3-yloxymethyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 63641042 |
| Molecular Formula | C10H12O4S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 3-(oxolan-3-yloxymethyl)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1COC1CCOC1 |
| InChI | InChI=1S/C10H12O4S/c11-10(12)9-7(2-4-15-9)5-14-8-1-3-13-6-8/h2,4,8H,1,3,5-6H2,(H,11,12) |
| InChIKey | CCWPUGHHEROLAH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |