C17H23FO4 — CID 146486184
tert-butyl 2-[5-fluoro-2-[[(3S)-oxolan-3-yl]oxymethyl]phenyl]acetate (PubChem CID 146486184) has the molecular formula C17H23FO4 and a molecular weight of 310.37 g/mol. Its IUPAC name is tert-butyl 2-[5-fluoro-2-[[(3S)-oxolan-3-yl]oxymethyl]phenyl]acetate.
| Compound Name | tert-butyl 2-[5-fluoro-2-[[(3S)-oxolan-3-yl]oxymethyl]phenyl]acetate |
|---|---|
| PubChem CID | 146486184 |
| Molecular Formula | C17H23FO4 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | tert-butyl 2-[5-fluoro-2-[[(3S)-oxolan-3-yl]oxymethyl]phenyl]acetate |
| SMILES | CC(C)(C)OC(=O)Cc1cc(F)ccc1CO[C@H]1CCOC1 |
| InChI | InChI=1S/C17H23FO4/c1-17(2,3)22-16(19)9-13-8-14(18)5-4-12(13)10-21-15-6-7-20-11-15/h4-5,8,15H,6-7,9-11H2,1-3H3/t15-/m0/s1 |
| InChIKey | JISWDDXAVPKVEW-HNNXBMFYSA-N |
| XLogP | 3.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |