C31H45BrN4O6 — CID 155038686
(2,5-dioxopyrrolidin-1-yl) (E,4S)-4-[[2-[[(2R)-3-(3-bromophenyl)-3-methyl-2-(methylamino)butanoyl]amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoate (PubChem CID 155038686) has the molecular formula C31H45BrN4O6 and a molecular weight of 649.63 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (E,4S)-4-[[2-[[(2R)-3-(3-bromophenyl)-3-methyl-2-(methylamino)butanoyl]amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (E,4S)-4-[[2-[[(2R)-3-(3-bromophenyl)-3-methyl-2-(methylamino)butanoyl]amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoate |
|---|---|
| PubChem CID | 155038686 |
| Molecular Formula | C31H45BrN4O6 |
| Molecular Weight | 649.63 g/mol |
| Exact Mass | 648.25 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (E,4S)-4-[[2-[[(2R)-3-(3-bromophenyl)-3-methyl-2-(methylamino)butanoyl]amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoate |
| SMILES | CN[C@@H](C(=O)NC(C(=O)N(C)[C@H](/C=C(\C)C(=O)ON1C(=O)CCC1=O)C(C)C)C(C)(C)C)C(C)(C)c1cccc(Br)c1 |
| InChI | InChI=1S/C31H45BrN4O6/c1-18(2)22(16-19(3)29(41)42-36-23(37)14-15-24(36)38)35(10)28(40)26(30(4,5)6)34-27(39)25(33-9)31(7,8)20-12-11-13-21(32)17-20/h11-13,16-18,22,25-26,33H,14-15H2,1-10H3,(H,34,39)/b19-16+/t22-,25+,26?/m1/s1 |
| InChIKey | LVGMHFHDCQXMPK-ZUABYHMASA-N |
| XLogP | 3.88 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.63 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|