C28H46IN4O4- — CID 166135992
(E,4S)-4-[[(2S)-3,3-dimethyl-2-[[3-methyl-2-(methylamino)-3-[3-(methyliodanuidylamino)phenyl]butanoyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid (PubChem CID 166135992) has the molecular formula C28H46IN4O4- and a molecular weight of 629.60 g/mol. Its IUPAC name is (E,4S)-4-[[(2S)-3,3-dimethyl-2-[[3-methyl-2-(methylamino)-3-[3-(methyliodanuidylamino)phenyl]butanoyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid.
| Compound Name | (E,4S)-4-[[(2S)-3,3-dimethyl-2-[[3-methyl-2-(methylamino)-3-[3-(methyliodanuidylamino)phenyl]butanoyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
|---|---|
| PubChem CID | 166135992 |
| Molecular Formula | C28H46IN4O4- |
| Molecular Weight | 629.60 g/mol |
| Exact Mass | 629.26 |
| IUPAC Name | (E,4S)-4-[[(2S)-3,3-dimethyl-2-[[3-methyl-2-(methylamino)-3-[3-(methyliodanuidylamino)phenyl]butanoyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
| SMILES | CNC(C(=O)N[C@H](C(=O)N(C)[C@H](/C=C(\C)C(=O)O)C(C)C)C(C)(C)C)C(C)(C)c1cccc(N[I-]C)c1 |
| InChI | InChI=1S/C28H46IN4O4/c1-17(2)21(15-18(3)26(36)37)33(11)25(35)23(27(4,5)6)31-24(34)22(30-10)28(7,8)19-13-12-14-20(16-19)32-29-9/h12-17,21-23,30,32H,1-11H3,(H,31,34)(H,36,37)/q-1/b18-15+/t21-,22?,23-/m1/s1 |
| InChIKey | YIKVNTYMMVAFIH-RUQRXOENSA-N |
| XLogP | 0.64 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.60 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|