C30H47N3O4 — CID 73061257
6-[[3,3-dimethyl-2-[[3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanoyl]-methylamino]-2,4,7-trimethylocta-2,4-dienoic acid (PubChem CID 73061257) has the molecular formula C30H47N3O4 and a molecular weight of 513.72 g/mol. Its IUPAC name is 6-[[3,3-dimethyl-2-[[3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanoyl]-methylamino]-2,4,7-trimethylocta-2,4-dienoic acid.
| Compound Name | 6-[[3,3-dimethyl-2-[[3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanoyl]-methylamino]-2,4,7-trimethylocta-2,4-dienoic acid |
|---|---|
| PubChem CID | 73061257 |
| Molecular Formula | C30H47N3O4 |
| Molecular Weight | 513.72 g/mol |
| Exact Mass | 513.36 |
| IUPAC Name | 6-[[3,3-dimethyl-2-[[3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanoyl]-methylamino]-2,4,7-trimethylocta-2,4-dienoic acid |
| SMILES | CNC(C(=O)NC(C(=O)N(C)C(C=C(C)C=C(C)C(=O)O)C(C)C)C(C)(C)C)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C30H47N3O4/c1-19(2)23(18-20(3)17-21(4)28(36)37)33(11)27(35)25(29(5,6)7)32-26(34)24(31-10)30(8,9)22-15-13-12-14-16-22/h12-19,23-25,31H,1-11H3,(H,32,34)(H,36,37) |
| InChIKey | QDZUHUOQKXBJJV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.72 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|