C27H44N4O3 — CID 21032342
N-[(E,6E)-6-hydroxyimino-2,5-dimethylhex-4-en-3-yl]-N,3,3-trimethyl-2-[[3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanamide (PubChem CID 21032342) has the molecular formula C27H44N4O3 and a molecular weight of 472.67 g/mol. Its IUPAC name is N-[(E,6E)-6-hydroxyimino-2,5-dimethylhex-4-en-3-yl]-N,3,3-trimethyl-2-[[3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanamide.
| Compound Name | N-[(E,6E)-6-hydroxyimino-2,5-dimethylhex-4-en-3-yl]-N,3,3-trimethyl-2-[[3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanamide |
|---|---|
| PubChem CID | 21032342 |
| Molecular Formula | C27H44N4O3 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.34 |
| IUPAC Name | N-[(E,6E)-6-hydroxyimino-2,5-dimethylhex-4-en-3-yl]-N,3,3-trimethyl-2-[[3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanamide |
| SMILES | CNC(C(=O)NC(C(=O)N(C)C(/C=C(C)/C=N/O)C(C)C)C(C)(C)C)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C27H44N4O3/c1-18(2)21(16-19(3)17-29-34)31(10)25(33)23(26(4,5)6)30-24(32)22(28-9)27(7,8)20-14-12-11-13-15-20/h11-18,21-23,28,34H,1-10H3,(H,30,32)/b19-16+,29-17+ |
| InChIKey | LOISYHXDWHQUCX-XFJOGQQNSA-N |
| XLogP | 3.97 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|