C11H17F3O2Si — CID 15503929
2,2,2-trifluoro-1-(2-trimethylsilyloxycyclohexen-1-yl)ethanone (PubChem CID 15503929) has the molecular formula C11H17F3O2Si and a molecular weight of 266.33 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(2-trimethylsilyloxycyclohexen-1-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(2-trimethylsilyloxycyclohexen-1-yl)ethanone |
|---|---|
| PubChem CID | 15503929 |
| Molecular Formula | C11H17F3O2Si |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2,2,2-trifluoro-1-(2-trimethylsilyloxycyclohexen-1-yl)ethanone |
| SMILES | C[Si](C)(C)OC1=C(C(=O)C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C11H17F3O2Si/c1-17(2,3)16-9-7-5-4-6-8(9)10(15)11(12,13)14/h4-7H2,1-3H3 |
| InChIKey | XRJNKYSTMIGXCX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|