C55H42N6 — CID 155039351
N-[[3-[3-[4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]methyl]-N'-(N-methyl-C-phenylcarbonimidoyl)benzenecarboximidamide (PubChem CID 155039351) has the molecular formula C55H42N6 and a molecular weight of 786.98 g/mol. Its IUPAC name is N-[[3-[3-[4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]methyl]-N'-(N-methyl-C-phenylcarbonimidoyl)benzenecarboximidamide.
| Compound Name | N-[[3-[3-[4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]methyl]-N'-(N-methyl-C-phenylcarbonimidoyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 155039351 |
| Molecular Formula | C55H42N6 |
| Molecular Weight | 786.98 g/mol |
| Exact Mass | 786.35 |
| IUPAC Name | N-[[3-[3-[4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]methyl]-N'-(N-methyl-C-phenylcarbonimidoyl)benzenecarboximidamide |
| SMILES | C/N=C(/N=C(/NCc1cccc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)n3)c2)c1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C55H42N6/c1-56-51(42-24-11-4-12-25-42)58-52(43-26-13-5-14-27-43)57-38-39-19-17-30-45(33-39)46-31-18-32-47(34-46)54-59-53(44-28-15-6-16-29-44)60-55(61-54)50-36-48(40-20-7-2-8-21-40)35-49(37-50)41-22-9-3-10-23-41/h2-37H,38H2,1H3,(H,56,57,58) |
| InChIKey | LPHWQTMDOVLZMM-UHFFFAOYSA-N |
| XLogP | 12.49 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.98 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|