C16H12F2N4O — CID 155041705
5-(2,6-difluoro-4-pyridinyl)-2-[6-(methylamino)pyridazin-3-yl]phenol (PubChem CID 155041705) has the molecular formula C16H12F2N4O and a molecular weight of 314.30 g/mol. Its IUPAC name is 5-(2,6-difluoro-4-pyridinyl)-2-[6-(methylamino)pyridazin-3-yl]phenol.
| Compound Name | 5-(2,6-difluoro-4-pyridinyl)-2-[6-(methylamino)pyridazin-3-yl]phenol |
|---|---|
| PubChem CID | 155041705 |
| Molecular Formula | C16H12F2N4O |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 5-(2,6-difluoro-4-pyridinyl)-2-[6-(methylamino)pyridazin-3-yl]phenol |
| SMILES | CNc1ccc(-c2ccc(-c3cc(F)nc(F)c3)cc2O)nn1 |
| InChI | InChI=1S/C16H12F2N4O/c1-19-16-5-4-12(21-22-16)11-3-2-9(6-13(11)23)10-7-14(17)20-15(18)8-10/h2-8,23H,1H3,(H,19,22) |
| InChIKey | SFKAZIZODUIRRP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|