C23H24N4O2 — CID 155042071
N-[(Z)-[1-methyl-4-[6-(piperidine-1-carbonyl)naphthalen-1-yl]-2-pyridinylidene]amino]formamide (PubChem CID 155042071) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[(Z)-[1-methyl-4-[6-(piperidine-1-carbonyl)naphthalen-1-yl]-2-pyridinylidene]amino]formamide.
| Compound Name | N-[(Z)-[1-methyl-4-[6-(piperidine-1-carbonyl)naphthalen-1-yl]-2-pyridinylidene]amino]formamide |
|---|---|
| PubChem CID | 155042071 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | N-[(Z)-[1-methyl-4-[6-(piperidine-1-carbonyl)naphthalen-1-yl]-2-pyridinylidene]amino]formamide |
| SMILES | Cn1ccc(-c2cccc3cc(C(=O)N4CCCCC4)ccc23)c/c1=N/NC=O |
| InChI | InChI=1S/C23H24N4O2/c1-26-13-10-18(15-22(26)25-24-16-28)20-7-5-6-17-14-19(8-9-21(17)20)23(29)27-11-3-2-4-12-27/h5-10,13-16H,2-4,11-12H2,1H3,(H,24,28)/b25-22- |
| InChIKey | VBHPALRAHAEPEV-LVWGJNHUSA-N |
| XLogP | 3.03 |
| TPSA | 66.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|