C12H23F2N — CID 155044430
4-butan-2-yl-2,2-difluoro-1-propan-2-ylpiperidine (PubChem CID 155044430) has the molecular formula C12H23F2N and a molecular weight of 219.32 g/mol. Its IUPAC name is 4-butan-2-yl-2,2-difluoro-1-propan-2-ylpiperidine.
| Compound Name | 4-butan-2-yl-2,2-difluoro-1-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 155044430 |
| Molecular Formula | C12H23F2N |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | 4-butan-2-yl-2,2-difluoro-1-propan-2-ylpiperidine |
| SMILES | CCC(C)C1CCN(C(C)C)C(F)(F)C1 |
| InChI | InChI=1S/C12H23F2N/c1-5-10(4)11-6-7-15(9(2)3)12(13,14)8-11/h9-11H,5-8H2,1-4H3 |
| InChIKey | QZCQUIWHHCJMOV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|