C24H32N4O6 — CID 155045578
4-[2-[2-[5-(4-prop-2-enoxyanilino)pyrimidin-2-yl]oxyethoxy]ethoxymethyl]piperidine-1-carboxylic acid (PubChem CID 155045578) has the molecular formula C24H32N4O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is 4-[2-[2-[5-(4-prop-2-enoxyanilino)pyrimidin-2-yl]oxyethoxy]ethoxymethyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[2-[2-[5-(4-prop-2-enoxyanilino)pyrimidin-2-yl]oxyethoxy]ethoxymethyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 155045578 |
| Molecular Formula | C24H32N4O6 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 4-[2-[2-[5-(4-prop-2-enoxyanilino)pyrimidin-2-yl]oxyethoxy]ethoxymethyl]piperidine-1-carboxylic acid |
| SMILES | C=CCOc1ccc(Nc2cnc(OCCOCCOCC3CCN(C(=O)O)CC3)nc2)cc1 |
| InChI | InChI=1S/C24H32N4O6/c1-2-11-33-22-5-3-20(4-6-22)27-21-16-25-23(26-17-21)34-15-14-31-12-13-32-18-19-7-9-28(10-8-19)24(29)30/h2-6,16-17,19,27H,1,7-15,18H2,(H,29,30) |
| InChIKey | MFQYXBTVUITJOY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|