C24H42O3 — CID 15504575
(2R,5R)-2-[(2-methylpropan-2-yl)oxy]-5-octoxy-6-phenylhexan-1-ol (PubChem CID 15504575) has the molecular formula C24H42O3 and a molecular weight of 378.60 g/mol. Its IUPAC name is (2R,5R)-2-[(2-methylpropan-2-yl)oxy]-5-octoxy-6-phenylhexan-1-ol.
| Compound Name | (2R,5R)-2-[(2-methylpropan-2-yl)oxy]-5-octoxy-6-phenylhexan-1-ol |
|---|---|
| PubChem CID | 15504575 |
| Molecular Formula | C24H42O3 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | (2R,5R)-2-[(2-methylpropan-2-yl)oxy]-5-octoxy-6-phenylhexan-1-ol |
| SMILES | CCCCCCCCO[C@H](CC[C@H](CO)OC(C)(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C24H42O3/c1-5-6-7-8-9-13-18-26-22(19-21-14-11-10-12-15-21)16-17-23(20-25)27-24(2,3)4/h10-12,14-15,22-23,25H,5-9,13,16-20H2,1-4H3/t22-,23-/m1/s1 |
| InChIKey | LEJXOSQWYZJSGV-DHIUTWEWSA-N |
| XLogP | 5.93 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|