C13H15NO — CID 15504952
N-(cyclopenta-2,4-dien-1-ylmethyl)-4-methoxyaniline (PubChem CID 15504952) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is N-(cyclopenta-2,4-dien-1-ylmethyl)-4-methoxyaniline.
| Compound Name | N-(cyclopenta-2,4-dien-1-ylmethyl)-4-methoxyaniline |
|---|---|
| PubChem CID | 15504952 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | N-(cyclopenta-2,4-dien-1-ylmethyl)-4-methoxyaniline |
| SMILES | COc1ccc(NCC2C=CC=C2)cc1 |
| InChI | InChI=1S/C13H15NO/c1-15-13-8-6-12(7-9-13)14-10-11-4-2-3-5-11/h2-9,11,14H,10H2,1H3 |
| InChIKey | PKUCVCYWVZPYES-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|