C9H17FN2O2 — CID 155049752
2-[(4-fluoro-1-methylpyrrolidin-3-yl)methyl-methylamino]acetic acid (PubChem CID 155049752) has the molecular formula C9H17FN2O2 and a molecular weight of 204.24 g/mol. Its IUPAC name is 2-[(4-fluoro-1-methylpyrrolidin-3-yl)methyl-methylamino]acetic acid.
| Compound Name | 2-[(4-fluoro-1-methylpyrrolidin-3-yl)methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 155049752 |
| Molecular Formula | C9H17FN2O2 |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-[(4-fluoro-1-methylpyrrolidin-3-yl)methyl-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)CC1CN(C)CC1F |
| InChI | InChI=1S/C9H17FN2O2/c1-11-3-7(8(10)5-11)4-12(2)6-9(13)14/h7-8H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | TXLLAGMIWORMDR-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |