C6H12FNO — CID 147748171
[(3S,4R)-4-fluoro-1-methylpyrrolidin-3-yl]methanol (PubChem CID 147748171) has the molecular formula C6H12FNO and a molecular weight of 133.17 g/mol. Its IUPAC name is [(3S,4R)-4-fluoro-1-methylpyrrolidin-3-yl]methanol.
| Compound Name | [(3S,4R)-4-fluoro-1-methylpyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 147748171 |
| Molecular Formula | C6H12FNO |
| Molecular Weight | 133.17 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | [(3S,4R)-4-fluoro-1-methylpyrrolidin-3-yl]methanol |
| SMILES | CN1C[C@@H](CO)[C@@H](F)C1 |
| InChI | InChI=1S/C6H12FNO/c1-8-2-5(4-9)6(7)3-8/h5-6,9H,2-4H2,1H3/t5-,6-/m0/s1 |
| InChIKey | HBRJQLSQSFVPHW-WDSKDSINSA-N |
| XLogP | -0.12 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.17 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |