C30H30N2O3S — CID 155052467
2-[4-[[6-butyl-5-(N-ethylanilino)-4-hydroxy-2-oxo-1H-pyridin-3-yl]sulfanyl]phenyl]benzaldehyde (PubChem CID 155052467) has the molecular formula C30H30N2O3S and a molecular weight of 498.65 g/mol. Its IUPAC name is 2-[4-[[6-butyl-5-(N-ethylanilino)-4-hydroxy-2-oxo-1H-pyridin-3-yl]sulfanyl]phenyl]benzaldehyde.
| Compound Name | 2-[4-[[6-butyl-5-(N-ethylanilino)-4-hydroxy-2-oxo-1H-pyridin-3-yl]sulfanyl]phenyl]benzaldehyde |
|---|---|
| PubChem CID | 155052467 |
| Molecular Formula | C30H30N2O3S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 2-[4-[[6-butyl-5-(N-ethylanilino)-4-hydroxy-2-oxo-1H-pyridin-3-yl]sulfanyl]phenyl]benzaldehyde |
| SMILES | CCCCc1[nH]c(=O)c(Sc2ccc(-c3ccccc3C=O)cc2)c(O)c1N(CC)c1ccccc1 |
| InChI | InChI=1S/C30H30N2O3S/c1-3-5-15-26-27(32(4-2)23-12-7-6-8-13-23)28(34)29(30(35)31-26)36-24-18-16-21(17-19-24)25-14-10-9-11-22(25)20-33/h6-14,16-20H,3-5,15H2,1-2H3,(H2,31,34,35) |
| InChIKey | SQGWMJNTAZWCIA-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|