C29H30FN3O2S — CID 155052465
6-butyl-5-(N,3-dimethylanilino)-3-[4-(6-fluoro-2-methyl-3-pyridinyl)phenyl]sulfanyl-4-hydroxy-1H-pyridin-2-one (PubChem CID 155052465) has the molecular formula C29H30FN3O2S and a molecular weight of 503.64 g/mol. Its IUPAC name is 6-butyl-5-(N,3-dimethylanilino)-3-[4-(6-fluoro-2-methyl-3-pyridinyl)phenyl]sulfanyl-4-hydroxy-1H-pyridin-2-one.
| Compound Name | 6-butyl-5-(N,3-dimethylanilino)-3-[4-(6-fluoro-2-methyl-3-pyridinyl)phenyl]sulfanyl-4-hydroxy-1H-pyridin-2-one |
|---|---|
| PubChem CID | 155052465 |
| Molecular Formula | C29H30FN3O2S |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 6-butyl-5-(N,3-dimethylanilino)-3-[4-(6-fluoro-2-methyl-3-pyridinyl)phenyl]sulfanyl-4-hydroxy-1H-pyridin-2-one |
| SMILES | CCCCc1[nH]c(=O)c(Sc2ccc(-c3ccc(F)nc3C)cc2)c(O)c1N(C)c1cccc(C)c1 |
| InChI | InChI=1S/C29H30FN3O2S/c1-5-6-10-24-26(33(4)21-9-7-8-18(2)17-21)27(34)28(29(35)32-24)36-22-13-11-20(12-14-22)23-15-16-25(30)31-19(23)3/h7-9,11-17H,5-6,10H2,1-4H3,(H2,32,34,35) |
| InChIKey | UCWCKALUDGCSSG-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|