C29H30FN3O5S — CID 139557817
6-butyl-3-[4-(6-fluoro-2-methyl-3-pyridinyl)phenyl]sulfonyl-4-hydroxy-5-(3-methoxy-N-methylanilino)-1H-pyridin-2-one (PubChem CID 139557817) has the molecular formula C29H30FN3O5S and a molecular weight of 551.64 g/mol. Its IUPAC name is 6-butyl-3-[4-(6-fluoro-2-methyl-3-pyridinyl)phenyl]sulfonyl-4-hydroxy-5-(3-methoxy-N-methylanilino)-1H-pyridin-2-one.
| Compound Name | 6-butyl-3-[4-(6-fluoro-2-methyl-3-pyridinyl)phenyl]sulfonyl-4-hydroxy-5-(3-methoxy-N-methylanilino)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 139557817 |
| Molecular Formula | C29H30FN3O5S |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | 6-butyl-3-[4-(6-fluoro-2-methyl-3-pyridinyl)phenyl]sulfonyl-4-hydroxy-5-(3-methoxy-N-methylanilino)-1H-pyridin-2-one |
| SMILES | CCCCc1[nH]c(=O)c(S(=O)(=O)c2ccc(-c3ccc(F)nc3C)cc2)c(O)c1N(C)c1cccc(OC)c1 |
| InChI | InChI=1S/C29H30FN3O5S/c1-5-6-10-24-26(33(3)20-8-7-9-21(17-20)38-4)27(34)28(29(35)32-24)39(36,37)22-13-11-19(12-14-22)23-15-16-25(30)31-18(23)2/h7-9,11-17H,5-6,10H2,1-4H3,(H2,32,34,35) |
| InChIKey | LMKWQOALCJZXBN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 112.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|