C10H19NO3 — CID 155055459
2-[(E)-3,3-dimethylhexan-2-ylideneamino]oxyacetic acid (PubChem CID 155055459) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-[(E)-3,3-dimethylhexan-2-ylideneamino]oxyacetic acid.
| Compound Name | 2-[(E)-3,3-dimethylhexan-2-ylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 155055459 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 2-[(E)-3,3-dimethylhexan-2-ylideneamino]oxyacetic acid |
| SMILES | CCCC(C)(C)/C(C)=N/OCC(=O)O |
| InChI | InChI=1S/C10H19NO3/c1-5-6-10(3,4)8(2)11-14-7-9(12)13/h5-7H2,1-4H3,(H,12,13)/b11-8+ |
| InChIKey | OAMDUIXLIIDWHB-DHZHZOJOSA-N |
| XLogP | 2.29 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|