C29H30N2O8 — CID 155056287
(E)-2-cyano-3-[4-[3-[4-[(E)-2-cyano-3-[2-(2-methylpropoxy)ethoxy]-3-oxoprop-1-enyl]phenoxy]-2-hydroxypropoxy]phenyl]prop-2-enoic acid (PubChem CID 155056287) has the molecular formula C29H30N2O8 and a molecular weight of 534.57 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-[3-[4-[(E)-2-cyano-3-[2-(2-methylpropoxy)ethoxy]-3-oxoprop-1-enyl]phenoxy]-2-hydroxypropoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[4-[3-[4-[(E)-2-cyano-3-[2-(2-methylpropoxy)ethoxy]-3-oxoprop-1-enyl]phenoxy]-2-hydroxypropoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 155056287 |
| Molecular Formula | C29H30N2O8 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | (E)-2-cyano-3-[4-[3-[4-[(E)-2-cyano-3-[2-(2-methylpropoxy)ethoxy]-3-oxoprop-1-enyl]phenoxy]-2-hydroxypropoxy]phenyl]prop-2-enoic acid |
| SMILES | CC(C)COCCOC(=O)/C(C#N)=C/c1ccc(OCC(O)COc2ccc(/C=C(\C#N)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C29H30N2O8/c1-20(2)17-36-11-12-37-29(35)24(16-31)14-22-5-9-27(10-6-22)39-19-25(32)18-38-26-7-3-21(4-8-26)13-23(15-30)28(33)34/h3-10,13-14,20,25,32H,11-12,17-19H2,1-2H3,(H,33,34)/b23-13+,24-14+ |
| InChIKey | KXHDSVRDMJADGT-RNIAWFEPSA-N |
| XLogP | 3.62 |
| TPSA | 159.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|