C25H35FN4 — CID 155056966
1-[(2-fluoro-6-methylphenyl)methyl]-N,N-dimethyl-4-[4-(4-methylpiperazin-1-yl)phenyl]pyrrolidin-3-amine (PubChem CID 155056966) has the molecular formula C25H35FN4 and a molecular weight of 410.58 g/mol. Its IUPAC name is 1-[(2-fluoro-6-methylphenyl)methyl]-N,N-dimethyl-4-[4-(4-methylpiperazin-1-yl)phenyl]pyrrolidin-3-amine.
| Compound Name | 1-[(2-fluoro-6-methylphenyl)methyl]-N,N-dimethyl-4-[4-(4-methylpiperazin-1-yl)phenyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 155056966 |
| Molecular Formula | C25H35FN4 |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | 1-[(2-fluoro-6-methylphenyl)methyl]-N,N-dimethyl-4-[4-(4-methylpiperazin-1-yl)phenyl]pyrrolidin-3-amine |
| SMILES | Cc1cccc(F)c1CN1CC(c2ccc(N3CCN(C)CC3)cc2)C(N(C)C)C1 |
| InChI | InChI=1S/C25H35FN4/c1-19-6-5-7-24(26)22(19)16-29-17-23(25(18-29)27(2)3)20-8-10-21(11-9-20)30-14-12-28(4)13-15-30/h5-11,23,25H,12-18H2,1-4H3 |
| InChIKey | KIYBUHVCPVJTJJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|