C28H40N4O2 — CID 163403918
tert-butyl 4-[4-[(3S,4R)-1-benzyl-4-(dimethylamino)pyrrolidin-3-yl]phenyl]piperazine-1-carboxylate (PubChem CID 163403918) has the molecular formula C28H40N4O2 and a molecular weight of 464.65 g/mol. Its IUPAC name is tert-butyl 4-[4-[(3S,4R)-1-benzyl-4-(dimethylamino)pyrrolidin-3-yl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(3S,4R)-1-benzyl-4-(dimethylamino)pyrrolidin-3-yl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 163403918 |
| Molecular Formula | C28H40N4O2 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.32 |
| IUPAC Name | tert-butyl 4-[4-[(3S,4R)-1-benzyl-4-(dimethylamino)pyrrolidin-3-yl]phenyl]piperazine-1-carboxylate |
| SMILES | CN(C)[C@H]1CN(Cc2ccccc2)C[C@@H]1c1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C28H40N4O2/c1-28(2,3)34-27(33)32-17-15-31(16-18-32)24-13-11-23(12-14-24)25-20-30(21-26(25)29(4)5)19-22-9-7-6-8-10-22/h6-14,25-26H,15-21H2,1-5H3/t25-,26+/m1/s1 |
| InChIKey | KKFIHEPCAJZCRP-FTJBHMTQSA-N |
| XLogP | 4.27 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|