C12H12N4O2S — CID 15505703
4-amino-6-methyl-3-phenacylsulfanyl-1,2,4-triazin-5-one (PubChem CID 15505703) has the molecular formula C12H12N4O2S and a molecular weight of 276.32 g/mol. Its IUPAC name is 4-amino-6-methyl-3-phenacylsulfanyl-1,2,4-triazin-5-one.
| Compound Name | 4-amino-6-methyl-3-phenacylsulfanyl-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 15505703 |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 4-amino-6-methyl-3-phenacylsulfanyl-1,2,4-triazin-5-one |
| SMILES | Cc1nnc(SCC(=O)c2ccccc2)n(N)c1=O |
| InChI | InChI=1S/C12H12N4O2S/c1-8-11(18)16(13)12(15-14-8)19-7-10(17)9-5-3-2-4-6-9/h2-6H,7,13H2,1H3 |
| InChIKey | LIQVDTUCDSWUDK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |