C13H11N5O3S — CID 7995267
2-[(4-amino-6-methyl-5-oxo-1,2,4-triazin-3-yl)sulfanylmethyl]isoindole-1,3-dione (PubChem CID 7995267) has the molecular formula C13H11N5O3S and a molecular weight of 317.33 g/mol. Its IUPAC name is 2-[(4-amino-6-methyl-5-oxo-1,2,4-triazin-3-yl)sulfanylmethyl]isoindole-1,3-dione.
| Compound Name | 2-[(4-amino-6-methyl-5-oxo-1,2,4-triazin-3-yl)sulfanylmethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 7995267 |
| Molecular Formula | C13H11N5O3S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 2-[(4-amino-6-methyl-5-oxo-1,2,4-triazin-3-yl)sulfanylmethyl]isoindole-1,3-dione |
| SMILES | Cc1nnc(SCN2C(=O)c3ccccc3C2=O)n(N)c1=O |
| InChI | InChI=1S/C13H11N5O3S/c1-7-10(19)18(14)13(16-15-7)22-6-17-11(20)8-4-2-3-5-9(8)12(17)21/h2-5H,6,14H2,1H3 |
| InChIKey | XEURNGSYSDIVRC-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|