C12H9N3O2S3 — CID 7898068
2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]isoindole-1,3-dione (PubChem CID 7898068) has the molecular formula C12H9N3O2S3 and a molecular weight of 323.42 g/mol. Its IUPAC name is 2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]isoindole-1,3-dione.
| Compound Name | 2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 7898068 |
| Molecular Formula | C12H9N3O2S3 |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | 2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]isoindole-1,3-dione |
| SMILES | CSc1nnc(SCN2C(=O)c3ccccc3C2=O)s1 |
| InChI | InChI=1S/C12H9N3O2S3/c1-18-11-13-14-12(20-11)19-6-15-9(16)7-4-2-3-5-8(7)10(15)17/h2-5H,6H2,1H3 |
| InChIKey | FMESUGZIEVLBAD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|