C12H9N3O2S2 — CID 3381295
2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]isoindole-1,3-dione (PubChem CID 3381295) has the molecular formula C12H9N3O2S2 and a molecular weight of 291.36 g/mol. Its IUPAC name is 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]isoindole-1,3-dione.
| Compound Name | 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 3381295 |
| Molecular Formula | C12H9N3O2S2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]isoindole-1,3-dione |
| SMILES | Cc1nnc(SCN2C(=O)c3ccccc3C2=O)s1 |
| InChI | InChI=1S/C12H9N3O2S2/c1-7-13-14-12(19-7)18-6-15-10(16)8-4-2-3-5-9(8)11(15)17/h2-5H,6H2,1H3 |
| InChIKey | KRNHTNMPNUZQRG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|