C10H19N — CID 15505992
4-butyl-1,2-dimethyl-2,5-dihydropyrrole (PubChem CID 15505992) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is 4-butyl-1,2-dimethyl-2,5-dihydropyrrole.
| Compound Name | 4-butyl-1,2-dimethyl-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 15505992 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 4-butyl-1,2-dimethyl-2,5-dihydropyrrole |
| SMILES | CCCCC1=CC(C)N(C)C1 |
| InChI | InChI=1S/C10H19N/c1-4-5-6-10-7-9(2)11(3)8-10/h7,9H,4-6,8H2,1-3H3 |
| InChIKey | UFFCRMCGARQHIO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|