C28H38N7O4S- — CID 155060163
[4-[[6-[(3R)-3-(3-azaspiro[5.5]undecane-9-carbonylamino)piperidin-1-yl]-3-carbamoylpyrazin-2-yl]amino]phenyl]methanesulfinate (PubChem CID 155060163) has the molecular formula C28H38N7O4S- and a molecular weight of 568.72 g/mol. Its IUPAC name is [4-[[6-[(3R)-3-(3-azaspiro[5.5]undecane-9-carbonylamino)piperidin-1-yl]-3-carbamoylpyrazin-2-yl]amino]phenyl]methanesulfinate.
| Compound Name | [4-[[6-[(3R)-3-(3-azaspiro[5.5]undecane-9-carbonylamino)piperidin-1-yl]-3-carbamoylpyrazin-2-yl]amino]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 155060163 |
| Molecular Formula | C28H38N7O4S- |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | [4-[[6-[(3R)-3-(3-azaspiro[5.5]undecane-9-carbonylamino)piperidin-1-yl]-3-carbamoylpyrazin-2-yl]amino]phenyl]methanesulfinate |
| SMILES | NC(=O)c1ncc(N2CCC[C@@H](NC(=O)C3CCC4(CCNCC4)CC3)C2)nc1Nc1ccc(CS(=O)[O-])cc1 |
| InChI | InChI=1S/C28H39N7O4S/c29-25(36)24-26(32-21-5-3-19(4-6-21)18-40(38)39)34-23(16-31-24)35-15-1-2-22(17-35)33-27(37)20-7-9-28(10-8-20)11-13-30-14-12-28/h3-6,16,20,22,30H,1-2,7-15,17-18H2,(H2,29,36)(H,32,34)(H,33,37)(H,38,39)/p-1/t22-/m1/s1 |
| InChIKey | GLRGKLKACYAYET-JOCHJYFZSA-M |
| XLogP | 2.34 |
| TPSA | 165.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|