C29H36FN5O3 — CID 155063984
3-[[4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-1-bicyclo[2.2.2]octanyl]methyl-[[(2R)-4-fluoro-2-formyl-2-bicyclo[2.1.1]hexanyl]methyl]amino]-N'-hydroxybenzenecarboximidamide (PubChem CID 155063984) has the molecular formula C29H36FN5O3 and a molecular weight of 521.64 g/mol. Its IUPAC name is 3-[[4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-1-bicyclo[2.2.2]octanyl]methyl-[[(2R)-4-fluoro-2-formyl-2-bicyclo[2.1.1]hexanyl]methyl]amino]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-[[4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-1-bicyclo[2.2.2]octanyl]methyl-[[(2R)-4-fluoro-2-formyl-2-bicyclo[2.1.1]hexanyl]methyl]amino]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 155063984 |
| Molecular Formula | C29H36FN5O3 |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | 3-[[4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-1-bicyclo[2.2.2]octanyl]methyl-[[(2R)-4-fluoro-2-formyl-2-bicyclo[2.1.1]hexanyl]methyl]amino]-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N\O)c1cccc(N(CC23CCC(c4nc(C5CC5)no4)(CC2)CC3)C[C@@]2(C=O)CC3(F)CC2C3)c1 |
| InChI | InChI=1S/C29H36FN5O3/c30-29-13-21(14-29)28(15-29,18-36)17-35(22-3-1-2-20(12-22)23(31)33-37)16-26-6-9-27(10-7-26,11-8-26)25-32-24(34-38-25)19-4-5-19/h1-3,12,18-19,21,37H,4-11,13-17H2,(H2,31,33)/t21?,26?,27?,28-,29?/m1/s1 |
| InChIKey | DLNNPBFTCKTMCC-BTPRXRHRSA-N |
| XLogP | 4.85 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|