C29H36FN5O2 — CID 162461654
N-[[4-(5-cyclopropyl-1-methylpyrazol-3-yl)-1-bicyclo[2.2.2]octanyl]methyl]-3-fluoro-N-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]bicyclo[1.1.1]pentane-1-carboxamide (PubChem CID 162461654) has the molecular formula C29H36FN5O2 and a molecular weight of 505.64 g/mol. Its IUPAC name is N-[[4-(5-cyclopropyl-1-methylpyrazol-3-yl)-1-bicyclo[2.2.2]octanyl]methyl]-3-fluoro-N-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]bicyclo[1.1.1]pentane-1-carboxamide.
| Compound Name | N-[[4-(5-cyclopropyl-1-methylpyrazol-3-yl)-1-bicyclo[2.2.2]octanyl]methyl]-3-fluoro-N-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]bicyclo[1.1.1]pentane-1-carboxamide |
|---|---|
| PubChem CID | 162461654 |
| Molecular Formula | C29H36FN5O2 |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | N-[[4-(5-cyclopropyl-1-methylpyrazol-3-yl)-1-bicyclo[2.2.2]octanyl]methyl]-3-fluoro-N-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]bicyclo[1.1.1]pentane-1-carboxamide |
| SMILES | Cn1nc(C23CCC(CN(C(=O)C45CC(F)(C4)C5)c4cccc(/C(N)=N/O)c4)(CC2)CC3)cc1C1CC1 |
| InChI | InChI=1S/C29H36FN5O2/c1-34-22(19-5-6-19)14-23(32-34)27-10-7-26(8-11-27,9-12-27)18-35(25(36)28-15-29(30,16-28)17-28)21-4-2-3-20(13-21)24(31)33-37/h2-4,13-14,19,37H,5-12,15-18H2,1H3,(H2,31,33) |
| InChIKey | FBHTVPCLZKORDO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|