C25H32FN3O4 — CID 155063946
methyl 4-[[N-(3-fluorobicyclo[2.1.1]hexane-1-carbonyl)-3-[(Z)-N'-hydroxycarbamimidoyl]anilino]methyl]bicyclo[2.2.2]octane-1-carboxylate (PubChem CID 155063946) has the molecular formula C25H32FN3O4 and a molecular weight of 457.55 g/mol. Its IUPAC name is methyl 4-[[N-(3-fluorobicyclo[2.1.1]hexane-1-carbonyl)-3-[(Z)-N'-hydroxycarbamimidoyl]anilino]methyl]bicyclo[2.2.2]octane-1-carboxylate.
| Compound Name | methyl 4-[[N-(3-fluorobicyclo[2.1.1]hexane-1-carbonyl)-3-[(Z)-N'-hydroxycarbamimidoyl]anilino]methyl]bicyclo[2.2.2]octane-1-carboxylate |
|---|---|
| PubChem CID | 155063946 |
| Molecular Formula | C25H32FN3O4 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | methyl 4-[[N-(3-fluorobicyclo[2.1.1]hexane-1-carbonyl)-3-[(Z)-N'-hydroxycarbamimidoyl]anilino]methyl]bicyclo[2.2.2]octane-1-carboxylate |
| SMILES | COC(=O)C12CCC(CN(C(=O)C34CC(F)C(C3)C4)c3cccc(/C(N)=N/O)c3)(CC1)CC2 |
| InChI | InChI=1S/C25H32FN3O4/c1-33-22(31)24-8-5-23(6-9-24,7-10-24)15-29(18-4-2-3-16(11-18)20(27)28-32)21(30)25-12-17(13-25)19(26)14-25/h2-4,11,17,19,32H,5-10,12-15H2,1H3,(H2,27,28) |
| InChIKey | QXFYBVOOKYCZNA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|