C22H33N5O3 — CID 155064653
1-(4,6-dihydroxy-3-propan-2-ylcyclohexa-1,3-diene-1-carboximidoyl)-1-[4-(piperazin-1-ylmethyl)cyclohexa-2,4-dien-1-yl]urea (PubChem CID 155064653) has the molecular formula C22H33N5O3 and a molecular weight of 415.54 g/mol. Its IUPAC name is 1-(4,6-dihydroxy-3-propan-2-ylcyclohexa-1,3-diene-1-carboximidoyl)-1-[4-(piperazin-1-ylmethyl)cyclohexa-2,4-dien-1-yl]urea.
| Compound Name | 1-(4,6-dihydroxy-3-propan-2-ylcyclohexa-1,3-diene-1-carboximidoyl)-1-[4-(piperazin-1-ylmethyl)cyclohexa-2,4-dien-1-yl]urea |
|---|---|
| PubChem CID | 155064653 |
| Molecular Formula | C22H33N5O3 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | 1-(4,6-dihydroxy-3-propan-2-ylcyclohexa-1,3-diene-1-carboximidoyl)-1-[4-(piperazin-1-ylmethyl)cyclohexa-2,4-dien-1-yl]urea |
| SMILES | [H]/N=C(\C1=CC(C(C)C)=C(O)CC1O)N(C(N)=O)C1C=CC(CN2CCNCC2)=CC1 |
| InChI | InChI=1S/C22H33N5O3/c1-14(2)17-11-18(20(29)12-19(17)28)21(23)27(22(24)30)16-5-3-15(4-6-16)13-26-9-7-25-8-10-26/h3-5,11,14,16,20,23,25,28-29H,6-10,12-13H2,1-2H3,(H2,24,30)/b23-21+ |
| InChIKey | CIHGBSQUOPNNJY-XTQSDGFTSA-N |
| XLogP | 1.66 |
| TPSA | 125.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|