C15H24N4O — CID 105351905
2-[4-(1,4-diazepan-1-ylmethyl)phenyl]propanehydrazide (PubChem CID 105351905) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-[4-(1,4-diazepan-1-ylmethyl)phenyl]propanehydrazide.
| Compound Name | 2-[4-(1,4-diazepan-1-ylmethyl)phenyl]propanehydrazide |
|---|---|
| PubChem CID | 105351905 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 2-[4-(1,4-diazepan-1-ylmethyl)phenyl]propanehydrazide |
| SMILES | CC(C(=O)NN)c1ccc(CN2CCCNCC2)cc1 |
| InChI | InChI=1S/C15H24N4O/c1-12(15(20)18-16)14-5-3-13(4-6-14)11-19-9-2-7-17-8-10-19/h3-6,12,17H,2,7-11,16H2,1H3,(H,18,20) |
| InChIKey | GXKFYXYSGPKYKI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|