C13H15IN4O — CID 105352253
2-[4-[(4-iodopyrazol-1-yl)methyl]phenyl]propanehydrazide (PubChem CID 105352253) has the molecular formula C13H15IN4O and a molecular weight of 370.19 g/mol. Its IUPAC name is 2-[4-[(4-iodopyrazol-1-yl)methyl]phenyl]propanehydrazide.
| Compound Name | 2-[4-[(4-iodopyrazol-1-yl)methyl]phenyl]propanehydrazide |
|---|---|
| PubChem CID | 105352253 |
| Molecular Formula | C13H15IN4O |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 2-[4-[(4-iodopyrazol-1-yl)methyl]phenyl]propanehydrazide |
| SMILES | CC(C(=O)NN)c1ccc(Cn2cc(I)cn2)cc1 |
| InChI | InChI=1S/C13H15IN4O/c1-9(13(19)17-15)11-4-2-10(3-5-11)7-18-8-12(14)6-16-18/h2-6,8-9H,7,15H2,1H3,(H,17,19) |
| InChIKey | WDCBYNUDATXZTK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|