C15H19N3O3 — CID 105352178
2-[4-[(2,6-dioxopiperidin-1-yl)methyl]phenyl]propanehydrazide (PubChem CID 105352178) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 2-[4-[(2,6-dioxopiperidin-1-yl)methyl]phenyl]propanehydrazide.
| Compound Name | 2-[4-[(2,6-dioxopiperidin-1-yl)methyl]phenyl]propanehydrazide |
|---|---|
| PubChem CID | 105352178 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-[4-[(2,6-dioxopiperidin-1-yl)methyl]phenyl]propanehydrazide |
| SMILES | CC(C(=O)NN)c1ccc(CN2C(=O)CCCC2=O)cc1 |
| InChI | InChI=1S/C15H19N3O3/c1-10(15(21)17-16)12-7-5-11(6-8-12)9-18-13(19)3-2-4-14(18)20/h5-8,10H,2-4,9,16H2,1H3,(H,17,21) |
| InChIKey | RCXYENCGEOLWNE-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|