C14H16N4O3 — CID 105352171
2-[4-[(2,4-dioxopyrimidin-1-yl)methyl]phenyl]propanehydrazide (PubChem CID 105352171) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is 2-[4-[(2,4-dioxopyrimidin-1-yl)methyl]phenyl]propanehydrazide.
| Compound Name | 2-[4-[(2,4-dioxopyrimidin-1-yl)methyl]phenyl]propanehydrazide |
|---|---|
| PubChem CID | 105352171 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 2-[4-[(2,4-dioxopyrimidin-1-yl)methyl]phenyl]propanehydrazide |
| SMILES | CC(C(=O)NN)c1ccc(Cn2ccc(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C14H16N4O3/c1-9(13(20)17-15)11-4-2-10(3-5-11)8-18-7-6-12(19)16-14(18)21/h2-7,9H,8,15H2,1H3,(H,17,20)(H,16,19,21) |
| InChIKey | USVBMYDIAPZKSM-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|