C24H21N3O3S — CID 155065339
(3R)-2-[(11R)-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-10-hydroxy-1,2,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-8,11-dione (PubChem CID 155065339) has the molecular formula C24H21N3O3S and a molecular weight of 431.52 g/mol. Its IUPAC name is (3R)-2-[(11R)-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-10-hydroxy-1,2,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-8,11-dione.
| Compound Name | (3R)-2-[(11R)-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-10-hydroxy-1,2,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-8,11-dione |
|---|---|
| PubChem CID | 155065339 |
| Molecular Formula | C24H21N3O3S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | (3R)-2-[(11R)-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-10-hydroxy-1,2,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-8,11-dione |
| SMILES | O=C1c2c(O)c(=O)ccn2N([C@@H]2c3ccccc3CSc3ccccc32)[C@@H]2CCCN12 |
| InChI | InChI=1S/C24H21N3O3S/c28-18-11-13-26-22(23(18)29)24(30)25-12-5-10-20(25)27(26)21-16-7-2-1-6-15(16)14-31-19-9-4-3-8-17(19)21/h1-4,6-9,11,13,20-21,29H,5,10,12,14H2/t20-,21-/m1/s1 |
| InChIKey | YFNREYYDAJXKFK-NHCUHLMSSA-N |
| XLogP | 3.46 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |