C24H19F2N3O3SSe — CID 170680789
(3R)-2-[(11R)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-11-hydroxy-5-selena-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione (PubChem CID 170680789) has the molecular formula C24H19F2N3O3SSe and a molecular weight of 546.46 g/mol. Its IUPAC name is (3R)-2-[(11R)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-11-hydroxy-5-selena-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione.
| Compound Name | (3R)-2-[(11R)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-11-hydroxy-5-selena-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 170680789 |
| Molecular Formula | C24H19F2N3O3SSe |
| Molecular Weight | 546.46 g/mol |
| Exact Mass | 547.03 |
| IUPAC Name | (3R)-2-[(11R)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-11-hydroxy-5-selena-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
| SMILES | O=C1c2c(O)c(=O)ccn2N([C@H]2c3ccccc3SCc3c2ccc(F)c3F)[C@@H]2C[Se]CCN12 |
| InChI | InChI=1S/C24H19F2N3O3SSe/c25-16-6-5-13-15(20(16)26)11-33-18-4-2-1-3-14(18)21(13)29-19-12-34-10-9-27(19)24(32)22-23(31)17(30)7-8-28(22)29/h1-8,19,21,31H,9-12H2/t19-,21-/m1/s1 |
| InChIKey | DLLNFULLTVZCHC-TZIWHRDSSA-N |
| XLogP | 3.50 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|