C27H25F2N3O3S — CID 155419866
3-cyclohexyl-1-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 155419866) has the molecular formula C27H25F2N3O3S and a molecular weight of 509.58 g/mol. Its IUPAC name is 3-cyclohexyl-1-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 3-cyclohexyl-1-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 155419866 |
| Molecular Formula | C27H25F2N3O3S |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | 3-cyclohexyl-1-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | O=C1c2c(O)c(=O)ccn2N([C@@H]2c3ccccc3SCc3c2ccc(F)c3F)CN1C1CCCCC1 |
| InChI | InChI=1S/C27H25F2N3O3S/c28-20-11-10-17-19(23(20)29)14-36-22-9-5-4-8-18(22)24(17)32-15-30(16-6-2-1-3-7-16)27(35)25-26(34)21(33)12-13-31(25)32/h4-5,8-13,16,24,34H,1-3,6-7,14-15H2/t24-/m0/s1 |
| InChIKey | LNEJGGFZDRYRKM-DEOSSOPVSA-N |
| XLogP | 4.91 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |