C31H33N3O5S — CID 139336635
1-[(11S)-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-hydroxy-3-[4-(oxolan-3-yloxy)cyclohexyl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 139336635) has the molecular formula C31H33N3O5S and a molecular weight of 559.69 g/mol. Its IUPAC name is 1-[(11S)-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-hydroxy-3-[4-(oxolan-3-yloxy)cyclohexyl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 1-[(11S)-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-hydroxy-3-[4-(oxolan-3-yloxy)cyclohexyl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 139336635 |
| Molecular Formula | C31H33N3O5S |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | 1-[(11S)-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-hydroxy-3-[4-(oxolan-3-yloxy)cyclohexyl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | O=C1c2c(O)c(=O)ccn2N([C@H]2c3ccccc3CSc3ccccc32)CN1C1CCC(OC2CCOC2)CC1 |
| InChI | InChI=1S/C31H33N3O5S/c35-26-13-15-33-29(30(26)36)31(37)32(21-9-11-22(12-10-21)39-23-14-16-38-17-23)19-34(33)28-24-6-2-1-5-20(24)18-40-27-8-4-3-7-25(27)28/h1-8,13,15,21-23,28,36H,9-12,14,16-19H2/t21?,22?,23?,28-/m0/s1 |
| InChIKey | UZTWSWMFYOVNIT-ZYYUKBQYSA-N |
| XLogP | 4.42 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |